C11H16FIN4 — CID 116515734
1-amino-2-butyl-3-(4-fluoro-2-iodophenyl)guanidine (PubChem CID 116515734) has the molecular formula C11H16FIN4 and a molecular weight of 350.18 g/mol. Its IUPAC name is 1-amino-2-butyl-3-(4-fluoro-2-iodophenyl)guanidine.
| Compound Name | 1-amino-2-butyl-3-(4-fluoro-2-iodophenyl)guanidine |
|---|---|
| PubChem CID | 116515734 |
| Molecular Formula | C11H16FIN4 |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-amino-2-butyl-3-(4-fluoro-2-iodophenyl)guanidine |
| SMILES | CCCC/N=C(\NN)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C11H16FIN4/c1-2-3-6-15-11(17-14)16-10-5-4-8(12)7-9(10)13/h4-5,7H,2-3,6,14H2,1H3,(H2,15,16,17) |
| InChIKey | NNTSNUYLHBKPAD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|