C13H17N — CID 143343070
2-methylidene-7-propyl-3,4-dihydro-1H-quinoline (PubChem CID 143343070) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-methylidene-7-propyl-3,4-dihydro-1H-quinoline.
| Compound Name | 2-methylidene-7-propyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 143343070 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-methylidene-7-propyl-3,4-dihydro-1H-quinoline |
| SMILES | C=C1CCc2ccc(CCC)cc2N1 |
| InChI | InChI=1S/C13H17N/c1-3-4-11-6-8-12-7-5-10(2)14-13(12)9-11/h6,8-9,14H,2-5,7H2,1H3 |
| InChIKey | UVQPCIQLYUBKOU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |