C18H28N2OS — CID 142171872
2-methylsulfanyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-isoquinoline (PubChem CID 142171872) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is 2-methylsulfanyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-methylsulfanyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 142171872 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-methylsulfanyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-isoquinoline |
| SMILES | CSN1CCc2ccc(OCCCN3CCCCC3)cc2C1 |
| InChI | InChI=1S/C18H28N2OS/c1-22-20-12-8-16-6-7-18(14-17(16)15-20)21-13-5-11-19-9-3-2-4-10-19/h6-7,14H,2-5,8-13,15H2,1H3 |
| InChIKey | XMKODQLYRBDGOY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|