C23H24NOP — CID 101474791
(1S)-2-diphenylphosphoryl-1-ethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 101474791) has the molecular formula C23H24NOP and a molecular weight of 361.43 g/mol. Its IUPAC name is (1S)-2-diphenylphosphoryl-1-ethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S)-2-diphenylphosphoryl-1-ethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 101474791 |
| Molecular Formula | C23H24NOP |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (1S)-2-diphenylphosphoryl-1-ethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CC[C@H]1c2ccccc2CCN1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24NOP/c1-2-23-22-16-10-9-11-19(22)17-18-24(23)26(25,20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-16,23H,2,17-18H2,1H3/t23-/m0/s1 |
| InChIKey | JDIOPQUXGKEOAM-QHCPKHFHSA-N |
| XLogP | 4.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|