C29H25N3O3 — CID 2005939
2-[[(1R)-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 2005939) has the molecular formula C29H25N3O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[[(1R)-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(1R)-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2005939 |
| Molecular Formula | C29H25N3O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[[(1R)-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN1CCc2ccccc2[C@@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H25N3O3/c1-18-27(23-12-6-7-13-24(23)30-18)26(33)17-31-15-14-19-8-2-3-9-20(19)25(31)16-32-28(34)21-10-4-5-11-22(21)29(32)35/h2-13,25,30H,14-17H2,1H3/t25-/m0/s1 |
| InChIKey | RQCOAXOOEURPHH-VWLOTQADSA-N |
| XLogP | 4.55 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|