C26H25N5O2 — CID 135652608
N-[2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminobenzamide (PubChem CID 135652608) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminobenzamide.
| Compound Name | N-[2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminobenzamide |
|---|---|
| PubChem CID | 135652608 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminobenzamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCCCC2c2cccnc2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H25N5O2/c32-25(19-9-2-1-3-10-19)29-28-24-21-12-4-5-14-23(21)31(26(24)33)18-30-16-7-6-13-22(30)20-11-8-15-27-17-20/h1-5,8-12,14-15,17,22,33H,6-7,13,16,18H2/b29-28+ |
| InChIKey | SWWMBVJOOKSYMI-ZQHSETAFSA-N |
| XLogP | 5.85 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|