C26H23BrClN5O2 — CID 4921767
N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]imino-4-chlorobenzamide (PubChem CID 4921767) has the molecular formula C26H23BrClN5O2 and a molecular weight of 552.86 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]imino-4-chlorobenzamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]imino-4-chlorobenzamide |
|---|---|
| PubChem CID | 4921767 |
| Molecular Formula | C26H23BrClN5O2 |
| Molecular Weight | 552.86 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]imino-4-chlorobenzamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCCCC2c2cccnc2)c2ccc(Br)cc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H23BrClN5O2/c27-19-8-11-23-21(14-19)24(30-31-25(34)17-6-9-20(28)10-7-17)26(35)33(23)16-32-13-2-1-5-22(32)18-4-3-12-29-15-18/h3-4,6-12,14-15,22,35H,1-2,5,13,16H2/b31-30+ |
| InChIKey | POBDXMYRTFHSKF-NVQSTNCTSA-N |
| XLogP | 7.27 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.86 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|