C24H22BrN5O3 — CID 3706513
N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminofuran-2-carboxamide (PubChem CID 3706513) has the molecular formula C24H22BrN5O3 and a molecular weight of 508.38 g/mol. Its IUPAC name is N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminofuran-2-carboxamide.
| Compound Name | N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminofuran-2-carboxamide |
|---|---|
| PubChem CID | 3706513 |
| Molecular Formula | C24H22BrN5O3 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | N-[5-bromo-2-hydroxy-1-[(2-pyridin-3-ylpiperidin-1-yl)methyl]indol-3-yl]iminofuran-2-carboxamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCCCC2c2cccnc2)c2ccc(Br)cc12)c1ccco1 |
| InChI | InChI=1S/C24H22BrN5O3/c25-17-8-9-20-18(13-17)22(27-28-23(31)21-7-4-12-33-21)24(32)30(20)15-29-11-2-1-6-19(29)16-5-3-10-26-14-16/h3-5,7-10,12-14,19,32H,1-2,6,11,15H2/b28-27+ |
| InChIKey | WRZFJRSVCKYUGY-BYYHNAKLSA-N |
| XLogP | 6.21 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|