C19H23N4O3+ — CID 135710479
diethyl-[2-[3-(furan-2-carbonyldiazenyl)-2-hydroxyindol-1-yl]ethyl]azanium (PubChem CID 135710479) has the molecular formula C19H23N4O3+ and a molecular weight of 355.42 g/mol. Its IUPAC name is diethyl-[2-[3-(furan-2-carbonyldiazenyl)-2-hydroxyindol-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[3-(furan-2-carbonyldiazenyl)-2-hydroxyindol-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 135710479 |
| Molecular Formula | C19H23N4O3+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | diethyl-[2-[3-(furan-2-carbonyldiazenyl)-2-hydroxyindol-1-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCn1c(O)c(/N=N/C(=O)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C19H22N4O3/c1-3-22(4-2)11-12-23-15-9-6-5-8-14(15)17(19(23)25)20-21-18(24)16-10-7-13-26-16/h5-10,13,25H,3-4,11-12H2,1-2H3/p+1/b21-20+ |
| InChIKey | IMHMRURCLZTQOZ-QZQOTICOSA-O |
| XLogP | 2.79 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|