C19H29N4O2+ — CID 135739771
diethyl-[2-[2-hydroxy-3-(3-methylbutanoyldiazenyl)indol-1-yl]ethyl]azanium (PubChem CID 135739771) has the molecular formula C19H29N4O2+ and a molecular weight of 345.47 g/mol. Its IUPAC name is diethyl-[2-[2-hydroxy-3-(3-methylbutanoyldiazenyl)indol-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[2-hydroxy-3-(3-methylbutanoyldiazenyl)indol-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 135739771 |
| Molecular Formula | C19H29N4O2+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | diethyl-[2-[2-hydroxy-3-(3-methylbutanoyldiazenyl)indol-1-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCn1c(O)c(/N=N/C(=O)CC(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H28N4O2/c1-5-22(6-2)11-12-23-16-10-8-7-9-15(16)18(19(23)25)21-20-17(24)13-14(3)4/h7-10,14,25H,5-6,11-13H2,1-4H3/p+1/b21-20+ |
| InChIKey | AATZRNHKSSNUDF-QZQOTICOSA-O |
| XLogP | 2.93 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|