C21H22N6O2 — CID 135846272
2-(benzotriazol-1-yl)-N-[2-hydroxy-1-(3-methylbutyl)indol-3-yl]iminoacetamide (PubChem CID 135846272) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[2-hydroxy-1-(3-methylbutyl)indol-3-yl]iminoacetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[2-hydroxy-1-(3-methylbutyl)indol-3-yl]iminoacetamide |
|---|---|
| PubChem CID | 135846272 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[2-hydroxy-1-(3-methylbutyl)indol-3-yl]iminoacetamide |
| SMILES | CC(C)CCn1c(O)c(/N=N/C(=O)Cn2nnc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C21H22N6O2/c1-14(2)11-12-26-17-9-5-3-7-15(17)20(21(26)29)24-23-19(28)13-27-18-10-6-4-8-16(18)22-25-27/h3-10,14,29H,11-13H2,1-2H3/b24-23+ |
| InChIKey | ABYMYOIWFACRCS-WCWDXBQESA-N |
| XLogP | 4.45 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|