C29H31N3O4 — CID 135629759
N-[2-hydroxy-1-[[4-(3-methylbutoxy)phenyl]methyl]indol-3-yl]imino-2-(2-methylphenoxy)acetamide (PubChem CID 135629759) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[2-hydroxy-1-[[4-(3-methylbutoxy)phenyl]methyl]indol-3-yl]imino-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[2-hydroxy-1-[[4-(3-methylbutoxy)phenyl]methyl]indol-3-yl]imino-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 135629759 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[2-hydroxy-1-[[4-(3-methylbutoxy)phenyl]methyl]indol-3-yl]imino-2-(2-methylphenoxy)acetamide |
| SMILES | Cc1ccccc1OCC(=O)/N=N/c1c(O)n(Cc2ccc(OCCC(C)C)cc2)c2ccccc12 |
| InChI | InChI=1S/C29H31N3O4/c1-20(2)16-17-35-23-14-12-22(13-15-23)18-32-25-10-6-5-9-24(25)28(29(32)34)31-30-27(33)19-36-26-11-7-4-8-21(26)3/h4-15,20,34H,16-19H2,1-3H3/b31-30+ |
| InChIKey | MVFUINYADPLJMD-NVQSTNCTSA-N |
| XLogP | 6.82 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|