C30H22N6O4 — CID 135468501
N-[1-(1,3-benzodioxol-5-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide (PubChem CID 135468501) has the molecular formula C30H22N6O4 and a molecular weight of 530.54 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 135468501 |
| Molecular Formula | C30H22N6O4 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-ylmethyl)-2-hydroxyindol-3-yl]imino-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide |
| SMILES | O=C(Cn1c(-c2ccccn2)nc2ccccc21)/N=N/c1c(O)n(Cc2ccc3c(c2)OCO3)c2ccccc12 |
| InChI | InChI=1S/C30H22N6O4/c37-27(17-35-24-11-4-2-8-21(24)32-29(35)22-9-5-6-14-31-22)33-34-28-20-7-1-3-10-23(20)36(30(28)38)16-19-12-13-25-26(15-19)40-18-39-25/h1-15,38H,16-18H2/b34-33+ |
| InChIKey | YJRTVSTXPMJGJF-JEIPZWNWSA-N |
| XLogP | 5.85 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|