C21H16ClN3O3S — CID 2461663
N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]iminobenzenesulfonamide (PubChem CID 2461663) has the molecular formula C21H16ClN3O3S and a molecular weight of 425.90 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]iminobenzenesulfonamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]iminobenzenesulfonamide |
|---|---|
| PubChem CID | 2461663 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]iminobenzenesulfonamide |
| SMILES | O=S(=O)(/N=N/c1c(O)n(Cc2ccccc2Cl)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H16ClN3O3S/c22-18-12-6-4-8-15(18)14-25-19-13-7-5-11-17(19)20(21(25)26)23-24-29(27,28)16-9-2-1-3-10-16/h1-13,26H,14H2/b24-23+ |
| InChIKey | HTRAGWBEYFTZQR-WCWDXBQESA-N |
| XLogP | 5.52 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|