C21H16ClN5O5S — CID 5009056
4-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-3-nitrobenzenesulfonamide (PubChem CID 5009056) has the molecular formula C21H16ClN5O5S and a molecular weight of 485.91 g/mol. Its IUPAC name is 4-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5009056 |
| Molecular Formula | C21H16ClN5O5S |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 4-[[1-[(2-chlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=N/c2c(O)n(Cc3ccccc3Cl)c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16ClN5O5S/c22-16-7-3-1-5-13(16)12-26-18-8-4-2-6-15(18)20(21(26)28)25-24-17-10-9-14(33(23,31)32)11-19(17)27(29)30/h1-11,28H,12H2,(H2,23,31,32)/b25-24+ |
| InChIKey | JUVQUCXRVSHXPV-OCOZRVBESA-N |
| XLogP | 5.02 |
| TPSA | 153.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|