C23H21N5O6S — CID 3358050
4-[(1-ethyl-2-hydroxyindol-3-yl)diazenyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 3358050) has the molecular formula C23H21N5O6S and a molecular weight of 495.52 g/mol. Its IUPAC name is 4-[(1-ethyl-2-hydroxyindol-3-yl)diazenyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(1-ethyl-2-hydroxyindol-3-yl)diazenyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3358050 |
| Molecular Formula | C23H21N5O6S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 4-[(1-ethyl-2-hydroxyindol-3-yl)diazenyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | CCn1c(O)c(/N=N/c2ccc(S(=O)(=O)Nc3ccccc3OC)cc2[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C23H21N5O6S/c1-3-27-19-10-6-4-8-16(19)22(23(27)29)25-24-17-13-12-15(14-20(17)28(30)31)35(32,33)26-18-9-5-7-11-21(18)34-2/h4-14,26,29H,3H2,1-2H3/b25-24+ |
| InChIKey | KGBQQFKUWYCBEG-OCOZRVBESA-N |
| XLogP | 5.50 |
| TPSA | 148.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|