C18H22N4O5S — CID 9060745
N-(2-methoxyphenyl)-3-nitro-4-[(2Z)-2-pentan-2-ylidenehydrazinyl]benzenesulfonamide (PubChem CID 9060745) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-nitro-4-[(2Z)-2-pentan-2-ylidenehydrazinyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-3-nitro-4-[(2Z)-2-pentan-2-ylidenehydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9060745 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-(2-methoxyphenyl)-3-nitro-4-[(2Z)-2-pentan-2-ylidenehydrazinyl]benzenesulfonamide |
| SMILES | CCC/C(C)=N\Nc1ccc(S(=O)(=O)Nc2ccccc2OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O5S/c1-4-7-13(2)19-20-15-11-10-14(12-17(15)22(23)24)28(25,26)21-16-8-5-6-9-18(16)27-3/h5-6,8-12,20-21H,4,7H2,1-3H3/b19-13- |
| InChIKey | KNLFMWSUGDRTOK-UYRXBGFRSA-N |
| XLogP | 3.99 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|