C30H23N5O6 — CID 157445350
1-benzyl-3-nitrosoindol-2-ol;1-[(2-nitrophenyl)methyl]-3-nitrosoindol-2-ol (PubChem CID 157445350) has the molecular formula C30H23N5O6 and a molecular weight of 549.54 g/mol. Its IUPAC name is 1-benzyl-3-nitrosoindol-2-ol;1-[(2-nitrophenyl)methyl]-3-nitrosoindol-2-ol.
| Compound Name | 1-benzyl-3-nitrosoindol-2-ol;1-[(2-nitrophenyl)methyl]-3-nitrosoindol-2-ol |
|---|---|
| PubChem CID | 157445350 |
| Molecular Formula | C30H23N5O6 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 1-benzyl-3-nitrosoindol-2-ol;1-[(2-nitrophenyl)methyl]-3-nitrosoindol-2-ol |
| SMILES | O=Nc1c(O)n(Cc2ccccc2)c2ccccc12.O=Nc1c(O)n(Cc2ccccc2[N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C15H11N3O4.C15H12N2O2/c19-15-14(16-20)11-6-2-4-8-13(11)17(15)9-10-5-1-3-7-12(10)18(21)22;18-15-14(16-19)12-8-4-5-9-13(12)17(15)10-11-6-2-1-3-7-11/h1-8,19H,9H2;1-9,18H,10H2 |
| InChIKey | MIBPPGZEPQEREY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 152.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|