C33H31N3O2 — CID 135645874
2-(4-tert-butylphenyl)-N-[2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]iminocyclopropane-1-carboxamide (PubChem CID 135645874) has the molecular formula C33H31N3O2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]iminocyclopropane-1-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]iminocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135645874 |
| Molecular Formula | C33H31N3O2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[2-hydroxy-1-(naphthalen-1-ylmethyl)indol-3-yl]iminocyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(C2CC2C(=O)/N=N/c2c(O)n(Cc3cccc4ccccc34)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H31N3O2/c1-33(2,3)24-17-15-22(16-18-24)27-19-28(27)31(37)35-34-30-26-13-6-7-14-29(26)36(32(30)38)20-23-11-8-10-21-9-4-5-12-25(21)23/h4-18,27-28,38H,19-20H2,1-3H3/b35-34+ |
| InChIKey | YMKNXEMUJYAQCO-XAHDOWKMSA-N |
| XLogP | 8.26 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|