C19H16BrN3O3 — CID 3838803
N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-methoxybenzamide (PubChem CID 3838803) has the molecular formula C19H16BrN3O3 and a molecular weight of 414.26 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-methoxybenzamide.
| Compound Name | N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-methoxybenzamide |
|---|---|
| PubChem CID | 3838803 |
| Molecular Formula | C19H16BrN3O3 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-2-methoxybenzamide |
| SMILES | C=CCn1c(O)c(/N=N/C(=O)c2ccccc2OC)c2cc(Br)ccc21 |
| InChI | InChI=1S/C19H16BrN3O3/c1-3-10-23-15-9-8-12(20)11-14(15)17(19(23)25)21-22-18(24)13-6-4-5-7-16(13)26-2/h3-9,11,25H,1,10H2,2H3/b22-21+ |
| InChIKey | POLVQYCSANEVFX-QURGRASLSA-N |
| XLogP | 5.23 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|