C23H20BrN5O3 — CID 135894651
N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 135894651) has the molecular formula C23H20BrN5O3 and a molecular weight of 494.35 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135894651 |
| Molecular Formula | C23H20BrN5O3 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-(5-bromo-2-hydroxy-1-prop-2-enylindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | C=CCn1c(O)c(/N=N/C(=O)c2cn(CC)c3nc(C)ccc3c2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H20BrN5O3/c1-4-10-29-18-9-7-14(24)11-16(18)19(23(29)32)26-27-22(31)17-12-28(5-2)21-15(20(17)30)8-6-13(3)25-21/h4,6-9,11-12,32H,1,5,10H2,2-3H3/b27-26+ |
| InChIKey | OWCAGPXGLULDKS-CYYJNZCTSA-N |
| XLogP | 5.26 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|