C27H23N5O3 — CID 135894645
N-(1-benzyl-2-hydroxyindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 135894645) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-(1-benzyl-2-hydroxyindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-benzyl-2-hydroxyindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135894645 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-(1-benzyl-2-hydroxyindol-3-yl)imino-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1cc(C(=O)/N=N/c2c(O)n(Cc3ccccc3)c3ccccc23)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C27H23N5O3/c1-3-31-16-21(24(33)20-14-13-17(2)28-25(20)31)26(34)30-29-23-19-11-7-8-12-22(19)32(27(23)35)15-18-9-5-4-6-10-18/h4-14,16,35H,3,15H2,1-2H3/b30-29+ |
| InChIKey | YDDPMGBPPSHIPZ-QVIHXGFCSA-N |
| XLogP | 5.36 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|