C29H26N6O4 — CID 137274643
1-ethyl-N-[1-[(2-hydroxy-1H-indol-3-yl)diazenyl]-1-oxo-3-phenylpropan-2-yl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 137274643) has the molecular formula C29H26N6O4 and a molecular weight of 522.57 g/mol. Its IUPAC name is 1-ethyl-N-[1-[(2-hydroxy-1H-indol-3-yl)diazenyl]-1-oxo-3-phenylpropan-2-yl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-ethyl-N-[1-[(2-hydroxy-1H-indol-3-yl)diazenyl]-1-oxo-3-phenylpropan-2-yl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 137274643 |
| Molecular Formula | C29H26N6O4 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 1-ethyl-N-[1-[(2-hydroxy-1H-indol-3-yl)diazenyl]-1-oxo-3-phenylpropan-2-yl]-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1cc(C(=O)NC(Cc2ccccc2)C(=O)/N=N/c2c(O)[nH]c3ccccc23)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C29H26N6O4/c1-3-35-16-21(25(36)20-14-13-17(2)30-26(20)35)27(37)32-23(15-18-9-5-4-6-10-18)28(38)34-33-24-19-11-7-8-12-22(19)31-29(24)39/h4-14,16,23,31,39H,3,15H2,1-2H3,(H,32,37)/b34-33+ |
| InChIKey | QLHQYRAFIQBPOL-JEIPZWNWSA-N |
| XLogP | 4.56 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|