C23H21N5O3 — CID 135894644
1-ethyl-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 135894644) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-ethyl-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-ethyl-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135894644 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-ethyl-N-(2-hydroxy-1-prop-2-enylindol-3-yl)imino-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | C=CCn1c(O)c(/N=N/C(=O)c2cn(CC)c3nc(C)ccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C23H21N5O3/c1-4-12-28-18-9-7-6-8-15(18)19(23(28)31)25-26-22(30)17-13-27(5-2)21-16(20(17)29)11-10-14(3)24-21/h4,6-11,13,31H,1,5,12H2,2-3H3/b26-25+ |
| InChIKey | UBWLHXQTUCHMRB-OCEACIFDSA-N |
| XLogP | 4.50 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|