C21H28N2O3 — CID 102200064
non-8-enyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 102200064) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is non-8-enyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | non-8-enyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 102200064 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | non-8-enyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | C=CCCCCCCCOC(=O)c1cn(CC)c2nc(C)ccc2c1=O |
| InChI | InChI=1S/C21H28N2O3/c1-4-6-7-8-9-10-11-14-26-21(25)18-15-23(5-2)20-17(19(18)24)13-12-16(3)22-20/h4,12-13,15H,1,5-11,14H2,2-3H3 |
| InChIKey | GFMRKIYNNLMXDY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|