C17H20N2O5 — CID 23276372
butanoyloxymethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 23276372) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is butanoyloxymethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | butanoyloxymethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 23276372 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | butanoyloxymethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCCC(=O)OCOC(=O)c1cn(CC)c2nc(C)ccc2c1=O |
| InChI | InChI=1S/C17H20N2O5/c1-4-6-14(20)23-10-24-17(22)13-9-19(5-2)16-12(15(13)21)8-7-11(3)18-16/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | YCPMGOBLONVZFZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|