C20H19ClN2O4 — CID 5164855
2-(2-chlorophenoxy)ethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 5164855) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 5164855 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCn1cc(C(=O)OCCOc2ccccc2Cl)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C20H19ClN2O4/c1-3-23-12-15(18(24)14-9-8-13(2)22-19(14)23)20(25)27-11-10-26-17-7-5-4-6-16(17)21/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | MKTOSHHPJUHHJR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|