C18H11BrClN3O2 — CID 5128171
N-(5-bromo-2-hydroxy-1-prop-2-ynylindol-3-yl)imino-2-chlorobenzamide (PubChem CID 5128171) has the molecular formula C18H11BrClN3O2 and a molecular weight of 416.66 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxy-1-prop-2-ynylindol-3-yl)imino-2-chlorobenzamide.
| Compound Name | N-(5-bromo-2-hydroxy-1-prop-2-ynylindol-3-yl)imino-2-chlorobenzamide |
|---|---|
| PubChem CID | 5128171 |
| Molecular Formula | C18H11BrClN3O2 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | N-(5-bromo-2-hydroxy-1-prop-2-ynylindol-3-yl)imino-2-chlorobenzamide |
| SMILES | C#CCn1c(O)c(/N=N/C(=O)c2ccccc2Cl)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H11BrClN3O2/c1-2-9-23-15-8-7-11(19)10-13(15)16(18(23)25)21-22-17(24)12-5-3-4-6-14(12)20/h1,3-8,10,25H,9H2/b22-21+ |
| InChIKey | BRLZTYNYOCSRJX-QURGRASLSA-N |
| XLogP | 5.32 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|