About N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide
N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide (PubChem CID 137172216) has the molecular formula C16H9BrClF2N3O2
and a molecular weight of 428.62 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide |
| PubChem CID | 137172216 |
| Molecular Formula | C16H9BrClF2N3O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)c2cc(F)c(F)cc2Cl)c2cc(Br)ccc21 |
| InChI | InChI=1S/C16H9BrClF2N3O2/c1-23-13-3-2-7(17)4-9(13)14(16(23)25)21-22-15(24)8-5-11(19)12(20)6-10(8)18/h2-6,25H,1H3/b22-21+ |
| InChIKey | SAELHNARWSZFPU-QURGRASLSA-N |
| XLogP | 5.50 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide?
The IUPAC name of N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide (CID 137172216) is N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide.
What is the SMILES notation for N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide?
The canonical SMILES for N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide is Cn1c(O)c(/N=N/C(=O)c2cc(F)c(F)cc2Cl)c2cc(Br)ccc21.
What is the InChIKey of N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide?
The InChIKey is SAELHNARWSZFPU-QURGRASLSA-N. The full InChI is InChI=1S/C16H9BrClF2N3O2/c1-23-13-3-2-7(17)4-9(13)14(16(23)25)21-22-15(24)8-5-11(19)12(20)6-10(8)18/h2-6,25H,1H3/b22-21+.
What are the key properties of N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide?
N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide has a molecular weight of 428.62 g/mol, XLogP of 5.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-chloro-4,5-difluorobenzamide is sourced from PubChem (CID 137172216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).