C12H9BrN6O4 — CID 4098278
4-amino-N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide (PubChem CID 4098278) has the molecular formula C12H9BrN6O4 and a molecular weight of 381.15 g/mol. Its IUPAC name is 4-amino-N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide.
| Compound Name | 4-amino-N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide |
|---|---|
| PubChem CID | 4098278 |
| Molecular Formula | C12H9BrN6O4 |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 4-amino-N-(5-bromo-2-hydroxy-1-methylindol-3-yl)imino-2-oxido-1,2,5-oxadiazol-2-ium-3-carboxamide |
| SMILES | Cn1c(O)c(/N=N/C(=O)c2c(N)no[n+]2[O-])c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H9BrN6O4/c1-18-7-3-2-5(13)4-6(7)8(12(18)21)15-16-11(20)9-10(14)17-23-19(9)22/h2-4,21H,1H3,(H2,14,17)/b16-15+ |
| InChIKey | KMKFPNXCVNQQDO-FOCLMDBBSA-N |
| XLogP | 1.77 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|