C28H24ClF3N4O4S — CID 135407392
4-[2-[3-[[2-chloro-3-(trifluoromethyl)phenyl]carbamoyldiazenyl]-2-hydroxy-1-propylindol-5-yl]sulfanylethyl]benzoic acid (PubChem CID 135407392) has the molecular formula C28H24ClF3N4O4S and a molecular weight of 605.04 g/mol. Its IUPAC name is 4-[2-[3-[[2-chloro-3-(trifluoromethyl)phenyl]carbamoyldiazenyl]-2-hydroxy-1-propylindol-5-yl]sulfanylethyl]benzoic acid.
| Compound Name | 4-[2-[3-[[2-chloro-3-(trifluoromethyl)phenyl]carbamoyldiazenyl]-2-hydroxy-1-propylindol-5-yl]sulfanylethyl]benzoic acid |
|---|---|
| PubChem CID | 135407392 |
| Molecular Formula | C28H24ClF3N4O4S |
| Molecular Weight | 605.04 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 4-[2-[3-[[2-chloro-3-(trifluoromethyl)phenyl]carbamoyldiazenyl]-2-hydroxy-1-propylindol-5-yl]sulfanylethyl]benzoic acid |
| SMILES | CCCn1c(O)c(/N=N/C(=O)Nc2cccc(C(F)(F)F)c2Cl)c2cc(SCCc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C28H24ClF3N4O4S/c1-2-13-36-22-11-10-18(41-14-12-16-6-8-17(9-7-16)26(38)39)15-19(22)24(25(36)37)34-35-27(40)33-21-5-3-4-20(23(21)29)28(30,31)32/h3-11,15,37H,2,12-14H2,1H3,(H,33,40)(H,38,39)/b35-34+ |
| InChIKey | HNAZBFUIJGEWJT-XAHDOWKMSA-N |
| XLogP | 8.78 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.04 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|