C30H31ClN4O4S — CID 135492852
4-[3-[3-[(3-chlorophenyl)carbamoyldiazenyl]-2-hydroxy-1-pentylindol-5-yl]sulfanylpropyl]benzoic acid (PubChem CID 135492852) has the molecular formula C30H31ClN4O4S and a molecular weight of 579.12 g/mol. Its IUPAC name is 4-[3-[3-[(3-chlorophenyl)carbamoyldiazenyl]-2-hydroxy-1-pentylindol-5-yl]sulfanylpropyl]benzoic acid.
| Compound Name | 4-[3-[3-[(3-chlorophenyl)carbamoyldiazenyl]-2-hydroxy-1-pentylindol-5-yl]sulfanylpropyl]benzoic acid |
|---|---|
| PubChem CID | 135492852 |
| Molecular Formula | C30H31ClN4O4S |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 4-[3-[3-[(3-chlorophenyl)carbamoyldiazenyl]-2-hydroxy-1-pentylindol-5-yl]sulfanylpropyl]benzoic acid |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)Nc2cccc(Cl)c2)c2cc(SCCCc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C30H31ClN4O4S/c1-2-3-4-16-35-26-15-14-24(40-17-6-7-20-10-12-21(13-11-20)29(37)38)19-25(26)27(28(35)36)33-34-30(39)32-23-9-5-8-22(31)18-23/h5,8-15,18-19,36H,2-4,6-7,16-17H2,1H3,(H,32,39)(H,37,38)/b34-33+ |
| InChIKey | UALFNSLJFYGPQZ-JEIPZWNWSA-N |
| XLogP | 8.93 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|