C29H28BrN5O3 — CID 135936687
N-[(Z)-3-[(5-bromo-2-hydroxy-1-propylindol-3-yl)diazenyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135936687) has the molecular formula C29H28BrN5O3 and a molecular weight of 574.48 g/mol. Its IUPAC name is N-[(Z)-3-[(5-bromo-2-hydroxy-1-propylindol-3-yl)diazenyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(5-bromo-2-hydroxy-1-propylindol-3-yl)diazenyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135936687 |
| Molecular Formula | C29H28BrN5O3 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | N-[(Z)-3-[(5-bromo-2-hydroxy-1-propylindol-3-yl)diazenyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCn1c(O)c(/N=N/C(=O)/C(=C/c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C29H28BrN5O3/c1-4-16-35-25-15-12-21(30)18-23(25)26(29(35)38)32-33-28(37)24(31-27(36)20-8-6-5-7-9-20)17-19-10-13-22(14-11-19)34(2)3/h5-15,17-18,38H,4,16H2,1-3H3,(H,31,36)/b24-17-,33-32+ |
| InChIKey | YCZLLRFBFBDFJA-JPKGLDDLSA-N |
| XLogP | 6.67 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|