C29H23N5O5 — CID 3817377
N-[1-(1,3-benzodioxol-5-yl)-3-[[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]diazenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3817377) has the molecular formula C29H23N5O5 and a molecular weight of 521.53 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-[[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]diazenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-[[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]diazenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3817377 |
| Molecular Formula | C29H23N5O5 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-[[1-(3-cyanopropyl)-2-hydroxyindol-3-yl]diazenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | N#CCCCn1c(O)c(/N=N/C(=O)C(=Cc2ccc3c(c2)OCO3)NC(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H23N5O5/c30-14-6-7-15-34-23-11-5-4-10-21(23)26(29(34)37)32-33-28(36)22(31-27(35)20-8-2-1-3-9-20)16-19-12-13-24-25(17-19)39-18-38-24/h1-5,8-13,16-17,37H,6-7,15,18H2,(H,31,35)/b22-16?,33-32+ |
| InChIKey | XAKLFDOJWRVFAN-IQINYDOISA-N |
| XLogP | 5.46 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|