C21H15N5O7 — CID 135547272
N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135547272) has the molecular formula C21H15N5O7 and a molecular weight of 449.38 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135547272 |
| Molecular Formula | C21H15N5O7 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c(=O)[nH]c1=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H15N5O7/c27-17(12-4-2-1-3-5-12)22-13(8-11-6-7-14-15(9-11)33-10-32-14)18(28)26-25-16-19(29)23-21(31)24-20(16)30/h1-9H,10H2,(H,22,27)(H3,23,24,29,30,31)/b13-8-,26-25+ |
| InChIKey | JESPNTMSGAGZEE-ZIIJSAJYSA-N |
| XLogP | 1.58 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|