C20H16ClN5O3 — CID 2011516
4-chloro-N-[2-[[1-(2-cyanoethyl)-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]benzamide (PubChem CID 2011516) has the molecular formula C20H16ClN5O3 and a molecular weight of 409.83 g/mol. Its IUPAC name is 4-chloro-N-[2-[[1-(2-cyanoethyl)-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[1-(2-cyanoethyl)-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2011516 |
| Molecular Formula | C20H16ClN5O3 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-chloro-N-[2-[[1-(2-cyanoethyl)-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]benzamide |
| SMILES | N#CCCn1c(O)c(/N=N/C(=O)CNC(=O)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H16ClN5O3/c21-14-8-6-13(7-9-14)19(28)23-12-17(27)24-25-18-15-4-1-2-5-16(15)26(20(18)29)11-3-10-22/h1-2,4-9,29H,3,11-12H2,(H,23,28)/b25-24+ |
| InChIKey | LKTDHRPASZXXTE-OCOZRVBESA-N |
| XLogP | 3.95 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|