C19H15N5O3 — CID 3984422
N-[2-[(2-hydroxy-1-prop-2-ynylindol-3-yl)diazenyl]-2-oxoethyl]pyridine-4-carboxamide (PubChem CID 3984422) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-1-prop-2-ynylindol-3-yl)diazenyl]-2-oxoethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[(2-hydroxy-1-prop-2-ynylindol-3-yl)diazenyl]-2-oxoethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3984422 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[2-[(2-hydroxy-1-prop-2-ynylindol-3-yl)diazenyl]-2-oxoethyl]pyridine-4-carboxamide |
| SMILES | C#CCn1c(O)c(/N=N/C(=O)CNC(=O)c2ccncc2)c2ccccc21 |
| InChI | InChI=1S/C19H15N5O3/c1-2-11-24-15-6-4-3-5-14(15)17(19(24)27)23-22-16(25)12-21-18(26)13-7-9-20-10-8-13/h1,3-10,27H,11-12H2,(H,21,26)/b23-22+ |
| InChIKey | DSHKWFMMLPMJAN-GHVJWSGMSA-N |
| XLogP | 2.42 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|