C34H29BrN4O5 — CID 3767476
N-[3-[[5-bromo-2-hydroxy-1-(2-phenylethyl)indol-3-yl]diazenyl]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3767476) has the molecular formula C34H29BrN4O5 and a molecular weight of 653.53 g/mol. Its IUPAC name is N-[3-[[5-bromo-2-hydroxy-1-(2-phenylethyl)indol-3-yl]diazenyl]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[[5-bromo-2-hydroxy-1-(2-phenylethyl)indol-3-yl]diazenyl]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3767476 |
| Molecular Formula | C34H29BrN4O5 |
| Molecular Weight | 653.53 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | N-[3-[[5-bromo-2-hydroxy-1-(2-phenylethyl)indol-3-yl]diazenyl]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)/N=N/c2c(O)n(CCc3ccccc3)c3ccc(Br)cc23)cc1OC |
| InChI | InChI=1S/C34H29BrN4O5/c1-43-29-16-13-23(20-30(29)44-2)19-27(36-32(40)24-11-7-4-8-12-24)33(41)38-37-31-26-21-25(35)14-15-28(26)39(34(31)42)18-17-22-9-5-3-6-10-22/h3-16,19-21,42H,17-18H2,1-2H3,(H,36,40)/b27-19?,38-37+ |
| InChIKey | ALISXADHEUTSIZ-OJGXMLNKSA-N |
| XLogP | 7.45 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.53 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|