C29H29N5O3 — CID 135419577
N-[(E)-1-[4-(diethylamino)phenyl]-3-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135419577) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[(E)-1-[4-(diethylamino)phenyl]-3-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(diethylamino)phenyl]-3-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135419577 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | N-[(E)-1-[4-(diethylamino)phenyl]-3-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)/N=N/c2c(O)n(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C29H29N5O3/c1-4-34(5-2)22-17-15-20(16-18-22)19-24(30-27(35)21-11-7-6-8-12-21)28(36)32-31-26-23-13-9-10-14-25(23)33(3)29(26)37/h6-19,37H,4-5H2,1-3H3,(H,30,35)/b24-19+,32-31+ |
| InChIKey | ADHLHLVMOXRSAL-GGOHEKFOSA-N |
| XLogP | 5.81 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|