C26H20N6O7 — CID 135506067
N-[(E)-3-[(2-hydroxy-1,7-dimethyl-5-nitroindol-3-yl)diazenyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135506067) has the molecular formula C26H20N6O7 and a molecular weight of 528.48 g/mol. Its IUPAC name is N-[(E)-3-[(2-hydroxy-1,7-dimethyl-5-nitroindol-3-yl)diazenyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[(2-hydroxy-1,7-dimethyl-5-nitroindol-3-yl)diazenyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135506067 |
| Molecular Formula | C26H20N6O7 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | N-[(E)-3-[(2-hydroxy-1,7-dimethyl-5-nitroindol-3-yl)diazenyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])cc2c(/N=N/C(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c(O)n(C)c12 |
| InChI | InChI=1S/C26H20N6O7/c1-15-12-19(32(38)39)14-20-22(26(35)30(2)23(15)20)28-29-25(34)21(27-24(33)17-6-4-3-5-7-17)13-16-8-10-18(11-9-16)31(36)37/h3-14,35H,1-2H3,(H,27,33)/b21-13+,29-28+ |
| InChIKey | YFBUPIXOIUOPML-JNJQKALHSA-N |
| XLogP | 5.09 |
| TPSA | 182.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|