C17H13BrN4O4 — CID 1381534
N-(5-bromo-2-hydroxy-1,7-dimethylindol-3-yl)imino-3-nitrobenzamide (PubChem CID 1381534) has the molecular formula C17H13BrN4O4 and a molecular weight of 417.22 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxy-1,7-dimethylindol-3-yl)imino-3-nitrobenzamide.
| Compound Name | N-(5-bromo-2-hydroxy-1,7-dimethylindol-3-yl)imino-3-nitrobenzamide |
|---|---|
| PubChem CID | 1381534 |
| Molecular Formula | C17H13BrN4O4 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | N-(5-bromo-2-hydroxy-1,7-dimethylindol-3-yl)imino-3-nitrobenzamide |
| SMILES | Cc1cc(Br)cc2c(/N=N/C(=O)c3cccc([N+](=O)[O-])c3)c(O)n(C)c12 |
| InChI | InChI=1S/C17H13BrN4O4/c1-9-6-11(18)8-13-14(17(24)21(2)15(9)13)19-20-16(23)10-4-3-5-12(7-10)22(25)26/h3-8,24H,1-2H3/b20-19+ |
| InChIKey | TXBGLXZABRHCJD-FMQUCBEESA-N |
| XLogP | 4.79 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|