C19H21N3O4 — CID 3490903
N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]imino-3-nitrobenzamide (PubChem CID 3490903) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]imino-3-nitrobenzamide.
| Compound Name | N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]imino-3-nitrobenzamide |
|---|---|
| PubChem CID | 3490903 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]imino-3-nitrobenzamide |
| SMILES | CC(C)c1cc(/N=N/C(=O)c2cccc([N+](=O)[O-])c2)cc(C(C)C)c1O |
| InChI | InChI=1S/C19H21N3O4/c1-11(2)16-9-14(10-17(12(3)4)18(16)23)20-21-19(24)13-6-5-7-15(8-13)22(25)26/h5-12,23H,1-4H3/b21-20+ |
| InChIKey | PZCLQPQMGNRURO-QZQOTICOSA-N |
| XLogP | 5.47 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|