C22H18N4O7 — CID 4659595
[4-[(3-nitrobenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate (PubChem CID 4659595) has the molecular formula C22H18N4O7 and a molecular weight of 450.41 g/mol. Its IUPAC name is [4-[(3-nitrobenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate.
| Compound Name | [4-[(3-nitrobenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 4659595 |
| Molecular Formula | C22H18N4O7 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [4-[(3-nitrobenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)ONc2ccc(/N=N/C(=O)c3cccc([N+](=O)[O-])c3)cc2)cc1OC |
| InChI | InChI=1S/C22H18N4O7/c1-31-19-11-6-15(13-20(19)32-2)22(28)33-25-17-9-7-16(8-10-17)23-24-21(27)14-4-3-5-18(12-14)26(29)30/h3-13,25H,1-2H3/b24-23+ |
| InChIKey | WQJZMDYPHVOJFK-WCWDXBQESA-N |
| XLogP | 4.72 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|