About [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate
[4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate (PubChem CID 4659116) has the molecular formula C20H12BrN5O7
and a molecular weight of 514.25 g/mol. Its IUPAC name is [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate.
Molecular Properties
| Compound Name | [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate |
| PubChem CID | 4659116 |
| Molecular Formula | C20H12BrN5O7 |
| Molecular Weight | 514.25 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate |
| SMILES | O=C(/N=N/c1ccc(NOC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1)c1ccccc1Br |
| InChI | InChI=1S/C20H12BrN5O7/c21-17-4-2-1-3-15(17)19(27)23-22-12-5-7-13(8-6-12)24-33-20(28)16-10-9-14(25(29)30)11-18(16)26(31)32/h1-11,24H/b23-22+ |
| InChIKey | GYXRLSMSNIBUMW-GHVJWSGMSA-N |
| XLogP | 5.37 |
| TPSA | 166.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.25 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate?
The IUPAC name of [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate (CID 4659116) is [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate.
What is the SMILES notation for [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate?
The canonical SMILES for [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate is O=C(/N=N/c1ccc(NOC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1)c1ccccc1Br.
What is the InChIKey of [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate?
The InChIKey is GYXRLSMSNIBUMW-GHVJWSGMSA-N. The full InChI is InChI=1S/C20H12BrN5O7/c21-17-4-2-1-3-15(17)19(27)23-22-12-5-7-13(8-6-12)24-33-20(28)16-10-9-14(25(29)30)11-18(16)26(31)32/h1-11,24H/b23-22+.
What are the key properties of [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate?
[4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate has a molecular weight of 514.25 g/mol, XLogP of 5.37, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-bromobenzoyl)diazenyl]anilino] 2,4-dinitrobenzoate is sourced from PubChem (CID 4659116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).