About [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate
[4-(benzoyldiazenyl)anilino] 3-methoxybenzoate (PubChem CID 5121044) has the molecular formula C21H17N3O4
and a molecular weight of 375.38 g/mol. Its IUPAC name is [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate |
| PubChem CID | 5121044 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)ONc2ccc(/N=N/C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H17N3O4/c1-27-19-9-5-8-16(14-19)21(26)28-24-18-12-10-17(11-13-18)22-23-20(25)15-6-3-2-4-7-15/h2-14,24H,1H3/b23-22+ |
| InChIKey | LFZHQDDXFIPRMJ-GHVJWSGMSA-N |
| XLogP | 4.80 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate?
The IUPAC name of [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate (CID 5121044) is [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate.
What is the SMILES notation for [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate?
The canonical SMILES for [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate is COc1cccc(C(=O)ONc2ccc(/N=N/C(=O)c3ccccc3)cc2)c1.
What is the InChIKey of [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate?
The InChIKey is LFZHQDDXFIPRMJ-GHVJWSGMSA-N. The full InChI is InChI=1S/C21H17N3O4/c1-27-19-9-5-8-16(14-19)21(26)28-24-18-12-10-17(11-13-18)22-23-20(25)15-6-3-2-4-7-15/h2-14,24H,1H3/b23-22+.
What are the key properties of [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate?
[4-(benzoyldiazenyl)anilino] 3-methoxybenzoate has a molecular weight of 375.38 g/mol, XLogP of 4.80, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzoyldiazenyl)anilino] 3-methoxybenzoate is sourced from PubChem (CID 5121044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).