About methyl 3-anilinooxybenzoate
methyl 3-anilinooxybenzoate (PubChem CID 54183467) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl 3-anilinooxybenzoate.
Molecular Properties
| Compound Name | methyl 3-anilinooxybenzoate |
| PubChem CID | 54183467 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl 3-anilinooxybenzoate |
| SMILES | COC(=O)c1cccc(ONc2ccccc2)c1 |
| InChI | InChI=1S/C14H13NO3/c1-17-14(16)11-6-5-9-13(10-11)18-15-12-7-3-2-4-8-12/h2-10,15H,1H3 |
| InChIKey | PDMJIZTUBXZMJW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-anilinooxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-anilinooxybenzoate?
The IUPAC name of methyl 3-anilinooxybenzoate (CID 54183467) is methyl 3-anilinooxybenzoate.
What is the SMILES notation for methyl 3-anilinooxybenzoate?
The canonical SMILES for methyl 3-anilinooxybenzoate is COC(=O)c1cccc(ONc2ccccc2)c1.
What is the InChIKey of methyl 3-anilinooxybenzoate?
The InChIKey is PDMJIZTUBXZMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3/c1-17-14(16)11-6-5-9-13(10-11)18-15-12-7-3-2-4-8-12/h2-10,15H,1H3.
What are the key properties of methyl 3-anilinooxybenzoate?
methyl 3-anilinooxybenzoate has a molecular weight of 243.26 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-anilinooxybenzoate is sourced from PubChem (CID 54183467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).