C23H21N3O5 — CID 7727333
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 3,5-dimethoxybenzoate (PubChem CID 7727333) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7727333 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H21N3O5/c1-29-20-12-16(13-21(14-20)30-2)23(28)31-15-22(27)24-17-8-10-19(11-9-17)26-25-18-6-4-3-5-7-18/h3-14H,15H2,1-2H3,(H,24,27)/b26-25+ |
| InChIKey | NRIPDLLCGAWMHL-OCEACIFDSA-N |
| XLogP | 4.91 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|