C20H12N6O9 — CID 4659594
[4-[(3-nitrobenzoyl)diazenyl]anilino] 3,5-dinitrobenzoate (PubChem CID 4659594) has the molecular formula C20H12N6O9 and a molecular weight of 480.35 g/mol. Its IUPAC name is [4-[(3-nitrobenzoyl)diazenyl]anilino] 3,5-dinitrobenzoate.
| Compound Name | [4-[(3-nitrobenzoyl)diazenyl]anilino] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 4659594 |
| Molecular Formula | C20H12N6O9 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [4-[(3-nitrobenzoyl)diazenyl]anilino] 3,5-dinitrobenzoate |
| SMILES | O=C(/N=N/c1ccc(NOC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12N6O9/c27-19(12-2-1-3-16(8-12)24(29)30)22-21-14-4-6-15(7-5-14)23-35-20(28)13-9-17(25(31)32)11-18(10-13)26(33)34/h1-11,23H/b22-21+ |
| InChIKey | MZKWXPKANMFRFC-QURGRASLSA-N |
| XLogP | 4.52 |
| TPSA | 209.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|