C22H19N3O7 — CID 5088307
[4-[(3,5-dihydroxybenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate (PubChem CID 5088307) has the molecular formula C22H19N3O7 and a molecular weight of 437.41 g/mol. Its IUPAC name is [4-[(3,5-dihydroxybenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate.
| Compound Name | [4-[(3,5-dihydroxybenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 5088307 |
| Molecular Formula | C22H19N3O7 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [4-[(3,5-dihydroxybenzoyl)diazenyl]anilino] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)ONc2ccc(/N=N/C(=O)c3cc(O)cc(O)c3)cc2)cc1OC |
| InChI | InChI=1S/C22H19N3O7/c1-30-19-8-3-13(11-20(19)31-2)22(29)32-25-16-6-4-15(5-7-16)23-24-21(28)14-9-17(26)12-18(27)10-14/h3-12,25-27H,1-2H3/b24-23+ |
| InChIKey | LHEAWTANDQOUME-WCWDXBQESA-N |
| XLogP | 4.22 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|