C20H18N2O5 — CID 166606852
N-[5-(3,4-dimethoxyphenyl)-2-hydroxyfuran-3-yl]imino-4-methylbenzamide (PubChem CID 166606852) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[5-(3,4-dimethoxyphenyl)-2-hydroxyfuran-3-yl]imino-4-methylbenzamide.
| Compound Name | N-[5-(3,4-dimethoxyphenyl)-2-hydroxyfuran-3-yl]imino-4-methylbenzamide |
|---|---|
| PubChem CID | 166606852 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[5-(3,4-dimethoxyphenyl)-2-hydroxyfuran-3-yl]imino-4-methylbenzamide |
| SMILES | COc1ccc(-c2cc(/N=N/C(=O)c3ccc(C)cc3)c(O)o2)cc1OC |
| InChI | InChI=1S/C20H18N2O5/c1-12-4-6-13(7-5-12)19(23)22-21-15-11-17(27-20(15)24)14-8-9-16(25-2)18(10-14)26-3/h4-11,24H,1-3H3/b22-21+ |
| InChIKey | SGFVAYPPPWCVNI-QURGRASLSA-N |
| XLogP | 4.90 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|